C23H36N6O2 — CID 111786055
N,N-dimethyl-2-[[[2-(7-methyl-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide (PubChem CID 111786055) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(7-methyl-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[2-(7-methyl-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111786055 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(7-methyl-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
| SMILES | Cc1cccc2c(CCN/C(=N/CC(=O)N(C)C)NCCCN3CCOCC3)c[nH]c12 |
| InChI | InChI=1S/C23H36N6O2/c1-18-6-4-7-20-19(16-26-22(18)20)8-10-25-23(27-17-21(30)28(2)3)24-9-5-11-29-12-14-31-15-13-29/h4,6-7,16,26H,5,8-15,17H2,1-3H3,(H2,24,25,27) |
| InChIKey | YNHWNMQPDUTRJB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|