C21H32FN5O — CID 111973438
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine (PubChem CID 111973438) has the molecular formula C21H32FN5O and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111973438 |
| Molecular Formula | C21H32FN5O |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(3-methyl-2-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H32FN5O/c1-15(2)20(27-8-10-28-11-9-27)14-26-21(23-3)24-7-6-16-13-25-19-5-4-17(22)12-18(16)19/h4-5,12-13,15,20,25H,6-11,14H2,1-3H3,(H2,23,24,26) |
| InChIKey | BIKPCZILRGXKNZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|