C20H19F4N3O — CID 86874108
3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 86874108) has the molecular formula C20H19F4N3O and a molecular weight of 393.38 g/mol. Its IUPAC name is 3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 86874108 |
| Molecular Formula | C20H19F4N3O |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-1-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C20H19F4N3O/c1-27(12-13-3-2-4-15(9-13)20(22,23)24)19(28)25-8-7-14-11-26-18-10-16(21)5-6-17(14)18/h2-6,9-11,26H,7-8,12H2,1H3,(H,25,28) |
| InChIKey | YVEFRWWMSNCNOQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |