C22H17F3N2OS — CID 31871936
2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 31871936) has the molecular formula C22H17F3N2OS and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 31871936 |
| Molecular Formula | C22H17F3N2OS |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | Cc1cccc(-c2nc(CC(=O)NCC#Cc3cccc(C(F)(F)F)c3)cs2)c1 |
| InChI | InChI=1S/C22H17F3N2OS/c1-15-5-2-8-17(11-15)21-27-19(14-29-21)13-20(28)26-10-4-7-16-6-3-9-18(12-16)22(23,24)25/h2-3,5-6,8-9,11-12,14H,10,13H2,1H3,(H,26,28) |
| InChIKey | VPEDJOZTSJCHTI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|