C20H16F3NO — CID 24676762
(E)-3-(2-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide (PubChem CID 24676762) has the molecular formula C20H16F3NO and a molecular weight of 343.35 g/mol. Its IUPAC name is (E)-3-(2-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 24676762 |
| Molecular Formula | C20H16F3NO |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (E)-3-(2-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide |
| SMILES | Cc1ccccc1/C=C/C(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3NO/c1-15-6-2-3-9-17(15)11-12-19(25)24-13-5-8-16-7-4-10-18(14-16)20(21,22)23/h2-4,6-7,9-12,14H,13H2,1H3,(H,24,25)/b12-11+ |
| InChIKey | DOKFRLLVSJNDMU-VAWYXSNFSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|