C17H11ClF3NOS — CID 24676799
(E)-3-(5-chlorothiophen-2-yl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide (PubChem CID 24676799) has the molecular formula C17H11ClF3NOS and a molecular weight of 369.80 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 24676799 |
| Molecular Formula | C17H11ClF3NOS |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)s1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF3NOS/c18-15-8-6-14(24-15)7-9-16(23)22-10-2-4-12-3-1-5-13(11-12)17(19,20)21/h1,3,5-9,11H,10H2,(H,22,23)/b9-7+ |
| InChIKey | KCQLCFOXRSZBLC-VQHVLOKHSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|