C21H21F3N2O2S — CID 24676795
5-(2,2-dimethylpropanoylamino)-3-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide (PubChem CID 24676795) has the molecular formula C21H21F3N2O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide.
| Compound Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24676795 |
| Molecular Formula | C21H21F3N2O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3N2O2S/c1-13-11-16(26-19(28)20(2,3)4)29-17(13)18(27)25-10-6-8-14-7-5-9-15(12-14)21(22,23)24/h5,7,9,11-12H,10H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | JFTNHFMBQCQQBH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|