C16H12F3N3O2S — CID 39058915
2-acetamido-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide (PubChem CID 39058915) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 2-acetamido-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 39058915 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-acetamido-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)NCC#Cc2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C16H12F3N3O2S/c1-10(23)21-15-22-13(9-25-15)14(24)20-7-3-5-11-4-2-6-12(8-11)16(17,18)19/h2,4,6,8-9H,7H2,1H3,(H,20,24)(H,21,22,23) |
| InChIKey | RYWFQHXEZUEHLO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|