C25H20N2O3S — CID 55962347
N-[(2-phenylmethoxy-4-pyridinyl)methyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 55962347) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[(2-phenylmethoxy-4-pyridinyl)methyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-[(2-phenylmethoxy-4-pyridinyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 55962347 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[(2-phenylmethoxy-4-pyridinyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | O=C(NCc1ccnc(OCc2ccccc2)c1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C25H20N2O3S/c28-24(22-11-6-14-31-22)20-9-4-5-10-21(20)25(29)27-16-19-12-13-26-23(15-19)30-17-18-7-2-1-3-8-18/h1-15H,16-17H2,(H,27,29) |
| InChIKey | NGACVTLMVCXGIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |