C19H24N2O3S — CID 4927444
N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 4927444) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4927444 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=O)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-13-10-14(2)12-16(11-13)21-25(23,24)17-8-6-15(7-9-17)20-18(22)19(3,4)5/h6-12,21H,1-5H3,(H,20,22) |
| InChIKey | CSRDLRNJYWERBT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |