C31H29BrN4O3S — CID 17317864
4-bromo-3-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 17317864) has the molecular formula C31H29BrN4O3S and a molecular weight of 617.57 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | 4-bromo-3-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17317864 |
| Molecular Formula | C31H29BrN4O3S |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 4-bromo-3-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccccc4C)CC3)cc2)cc2ccccc2c1Br |
| InChI | InChI=1S/C31H29BrN4O3S/c1-20-7-3-5-9-24(20)30(38)36-17-15-35(16-18-36)23-13-11-22(12-14-23)33-31(40)34-29(37)26-19-21-8-4-6-10-25(21)27(32)28(26)39-2/h3-14,19H,15-18H2,1-2H3,(H2,33,34,37,40) |
| InChIKey | MJLXHCIUUXCEDI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|