C21H18BrN3O5S2 — CID 17315466
N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide (PubChem CID 17315466) has the molecular formula C21H18BrN3O5S2 and a molecular weight of 536.43 g/mol. Its IUPAC name is N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17315466 |
| Molecular Formula | C21H18BrN3O5S2 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(C)=O)cc2)cc2ccccc2c1Br |
| InChI | InChI=1S/C21H18BrN3O5S2/c1-12(26)25-32(28,29)15-9-7-14(8-10-15)23-21(31)24-20(27)17-11-13-5-3-4-6-16(13)18(22)19(17)30-2/h3-11H,1-2H3,(H,25,26)(H2,23,24,27,31) |
| InChIKey | HXGHBUKDQIHVDF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|