C27H22BrN5O2S — CID 17315415
4-bromo-3-methoxy-N-[[6-methyl-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]naphthalene-2-carboxamide (PubChem CID 17315415) has the molecular formula C27H22BrN5O2S and a molecular weight of 560.48 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N-[[6-methyl-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]naphthalene-2-carboxamide.
| Compound Name | 4-bromo-3-methoxy-N-[[6-methyl-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17315415 |
| Molecular Formula | C27H22BrN5O2S |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 4-bromo-3-methoxy-N-[[6-methyl-2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]naphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cc3nn(-c4ccc(C)cc4)nc3cc2C)cc2ccccc2c1Br |
| InChI | InChI=1S/C27H22BrN5O2S/c1-15-8-10-18(11-9-15)33-31-22-12-16(2)21(14-23(22)32-33)29-27(36)30-26(34)20-13-17-6-4-5-7-19(17)24(28)25(20)35-3/h4-14H,1-3H3,(H2,29,30,34,36) |
| InChIKey | KXFWKCWNUYGGFR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|