C26H25N3O4S — CID 1138944
N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 1138944) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1138944 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4cc(C)cc(C)c4o3)ccc2C)cc1OC |
| InChI | InChI=1S/C26H25N3O4S/c1-14-10-16(3)23-20(11-14)27-25(33-23)18-7-6-15(2)19(12-18)28-26(34)29-24(30)17-8-9-21(31-4)22(13-17)32-5/h6-13H,1-5H3,(H2,28,29,30,34) |
| InChIKey | APWHXNMYTVJBLY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|