C25H23N3O3S — CID 135717985
N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 135717985) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 135717985 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(NC(=S)NC(=O)c4ccc(C)c(C)c4)cc3O)nc2c1 |
| InChI | InChI=1S/C25H23N3O3S/c1-13-9-16(4)22-20(10-13)27-24(31-22)19-8-7-18(12-21(19)29)26-25(32)28-23(30)17-6-5-14(2)15(3)11-17/h5-12,29H,1-4H3,(H2,26,28,30,32) |
| InChIKey | QRDGJRNCDDPEAB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|