C24H19N3O5S — CID 4620784
N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4620784) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4620784 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(NC(=S)NC(=O)c4ccc5c(c4)OCO5)cc3O)nc2c1 |
| InChI | InChI=1S/C24H19N3O5S/c1-12-7-13(2)21-17(8-12)26-23(32-21)16-5-4-15(10-18(16)28)25-24(33)27-22(29)14-3-6-19-20(9-14)31-11-30-19/h3-10,28H,11H2,1-2H3,(H2,25,27,29,33) |
| InChIKey | KZLWVOKVIWSHAF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|