C27H25N5O6S — CID 137066968
N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 137066968) has the molecular formula C27H25N5O6S and a molecular weight of 547.59 g/mol. Its IUPAC name is N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 137066968 |
| Molecular Formula | C27H25N5O6S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1cc(C)c2oc(-c3cc(NC(=S)NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)ccc3O)nc2c1 |
| InChI | InChI=1S/C27H25N5O6S/c1-15-11-16(2)24-20(12-15)29-26(38-24)19-14-18(4-6-23(19)33)28-27(39)30-25(34)17-3-5-21(22(13-17)32(35)36)31-7-9-37-10-8-31/h3-6,11-14,33H,7-10H2,1-2H3,(H2,28,30,34,39) |
| InChIKey | NOICXYIAUVDVRS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 143.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|