C23H18BrN3O3S — CID 135775843
3-bromo-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]benzamide (PubChem CID 135775843) has the molecular formula C23H18BrN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is 3-bromo-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 135775843 |
| Molecular Formula | C23H18BrN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 3-bromo-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)c2oc(-c3cc(NC(=S)NC(=O)c4cccc(Br)c4)ccc3O)nc2c1 |
| InChI | InChI=1S/C23H18BrN3O3S/c1-12-8-13(2)20-18(9-12)26-22(30-20)17-11-16(6-7-19(17)28)25-23(31)27-21(29)14-4-3-5-15(24)10-14/h3-11,28H,1-2H3,(H2,25,27,29,31) |
| InChIKey | MBPHPIAZWGUCHP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|