C22H17FN2O3 — CID 135610414
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2-fluorobenzamide (PubChem CID 135610414) has the molecular formula C22H17FN2O3 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2-fluorobenzamide.
| Compound Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 135610414 |
| Molecular Formula | C22H17FN2O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2-fluorobenzamide |
| SMILES | Cc1cc(C)c2oc(-c3cc(NC(=O)c4ccccc4F)ccc3O)nc2c1 |
| InChI | InChI=1S/C22H17FN2O3/c1-12-9-13(2)20-18(10-12)25-22(28-20)16-11-14(7-8-19(16)26)24-21(27)15-5-3-4-6-17(15)23/h3-11,26H,1-2H3,(H,24,27) |
| InChIKey | JRJZRCZWIISYAU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|