C24H22N2O5 — CID 135645410
N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dimethoxybenzamide (PubChem CID 135645410) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 135645410 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(O)c(-c3nc4cc(C)cc(C)c4o3)c2)c(OC)c1 |
| InChI | InChI=1S/C24H22N2O5/c1-13-9-14(2)22-19(10-13)26-24(31-22)18-11-15(5-8-20(18)27)25-23(28)17-7-6-16(29-3)12-21(17)30-4/h5-12,27H,1-4H3,(H,25,28) |
| InChIKey | QDBWTYAMWBLHAQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|