C24H19Cl2N3O4S — CID 137118511
3,5-dichloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 137118511) has the molecular formula C24H19Cl2N3O4S and a molecular weight of 516.41 g/mol. Its IUPAC name is 3,5-dichloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 137118511 |
| Molecular Formula | C24H19Cl2N3O4S |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 3,5-dichloro-N-[[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1ccc(O)c(-c2nc3cc(C)cc(C)c3o2)c1 |
| InChI | InChI=1S/C24H19Cl2N3O4S/c1-11-6-12(2)20-18(7-11)28-23(33-20)15-10-14(4-5-19(15)30)27-24(34)29-22(31)16-8-13(25)9-17(26)21(16)32-3/h4-10,30H,1-3H3,(H2,27,29,31,34) |
| InChIKey | DECUBNQWBSDYDI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|