C24H20ClN3O3S — CID 135717999
2-(4-chlorophenyl)-N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide (PubChem CID 135717999) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 135717999 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[4-(5,7-dimethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]acetamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(NC(=S)NC(=O)Cc4ccc(Cl)cc4)cc3O)nc2c1 |
| InChI | InChI=1S/C24H20ClN3O3S/c1-13-9-14(2)22-19(10-13)27-23(31-22)18-8-7-17(12-20(18)29)26-24(32)28-21(30)11-15-3-5-16(25)6-4-15/h3-10,12,29H,11H2,1-2H3,(H2,26,28,30,32) |
| InChIKey | ZWUVWGWESCQRJD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|