C24H17F4N3O4S — CID 17315605
2,3,5,6-tetrafluoro-4-methoxy-N-[[5-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide (PubChem CID 17315605) has the molecular formula C24H17F4N3O4S and a molecular weight of 519.48 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[[5-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[5-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17315605 |
| Molecular Formula | C24H17F4N3O4S |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[5-(5-methoxy-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc2oc(-c3ccc(C)c(NC(=S)NC(=O)c4c(F)c(F)c(OC)c(F)c4F)c3)nc2c1 |
| InChI | InChI=1S/C24H17F4N3O4S/c1-10-4-5-11(23-29-14-9-12(33-2)6-7-15(14)35-23)8-13(10)30-24(36)31-22(32)16-17(25)19(27)21(34-3)20(28)18(16)26/h4-9H,1-3H3,(H2,30,31,32,36) |
| InChIKey | JCBXHOADQPUQOG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|