C22H32N2O4 — CID 72690093
tert-butyl N-[2-[3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate (PubChem CID 72690093) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate |
|---|---|
| PubChem CID | 72690093 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl N-[2-[3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate |
| SMILES | CCC(CC)(CNC(=O)OC(C)(C)C)NC(=O)C=Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C22H32N2O4/c1-6-22(7-2,15-23-20(26)28-21(3,4)5)24-19(25)11-9-16-8-10-18-17(14-16)12-13-27-18/h8-11,14H,6-7,12-13,15H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | GXSUVPVNHZAPTA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|