C23H34ClN3O3 — CID 14306926
2,2,5,5-tetramethyl-N-[2-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]ethyl]-1H-pyrrole-3-carboxamide;hydrochloride (PubChem CID 14306926) has the molecular formula C23H34ClN3O3 and a molecular weight of 436.00 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[2-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]ethyl]-1H-pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 2,2,5,5-tetramethyl-N-[2-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]ethyl]-1H-pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 14306926 |
| Molecular Formula | C23H34ClN3O3 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[2-[[2-(4-methyl-2-prop-2-enylphenoxy)acetyl]amino]ethyl]-1H-pyrrole-3-carboxamide;hydrochloride |
| SMILES | C=CCc1cc(C)ccc1OCC(=O)NCCNC(=O)C1=CC(C)(C)NC1(C)C.Cl |
| InChI | InChI=1S/C23H33N3O3.ClH/c1-7-8-17-13-16(2)9-10-19(17)29-15-20(27)24-11-12-25-21(28)18-14-22(3,4)26-23(18,5)6;/h7,9-10,13-14,26H,1,8,11-12,15H2,2-6H3,(H,24,27)(H,25,28);1H |
| InChIKey | XQPOGMPSBLZLDO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|