C22H27NO4 — CID 33105392
N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide (PubChem CID 33105392) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide.
| Compound Name | N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
|---|---|
| PubChem CID | 33105392 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(2-methoxy-4-prop-2-enylphenoxy)acetamide |
| SMILES | C=CCc1ccc(OCC(=O)NCCc2cc(C)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H27NO4/c1-5-6-17-8-10-20(21(14-17)26-4)27-15-22(24)23-12-11-18-13-16(2)7-9-19(18)25-3/h5,7-10,13-14H,1,6,11-12,15H2,2-4H3,(H,23,24) |
| InChIKey | KXPFXDHVXMPHTC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|