C33H39N3O4 — CID 16978712
2-(2,5-dimethylphenoxy)-N-[2-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16978712) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[2-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[2-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16978712 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[2-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CCNC(=O)COc3cc(C)ccc3C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C33H39N3O4/c1-5-10-26-15-16-29(31(22-26)38-4)39-20-9-8-19-36-28-12-7-6-11-27(28)35-32(36)17-18-34-33(37)23-40-30-21-24(2)13-14-25(30)3/h5-7,11-16,21-22H,1,8-10,17-20,23H2,2-4H3,(H,34,37) |
| InChIKey | XEUCCZZCPKUVJQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|