C25H38ClN3O4 — CID 14306921
N-[3-[2-(2-methoxy-4-prop-2-enylphenoxy)propanoylamino]propyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;hydrochloride (PubChem CID 14306921) has the molecular formula C25H38ClN3O4 and a molecular weight of 480.05 g/mol. Its IUPAC name is N-[3-[2-(2-methoxy-4-prop-2-enylphenoxy)propanoylamino]propyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;hydrochloride.
| Compound Name | N-[3-[2-(2-methoxy-4-prop-2-enylphenoxy)propanoylamino]propyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 14306921 |
| Molecular Formula | C25H38ClN3O4 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[3-[2-(2-methoxy-4-prop-2-enylphenoxy)propanoylamino]propyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;hydrochloride |
| SMILES | C=CCc1ccc(OC(C)C(=O)NCCCNC(=O)C2=CC(C)(C)NC2(C)C)c(OC)c1.Cl |
| InChI | InChI=1S/C25H37N3O4.ClH/c1-8-10-18-11-12-20(21(15-18)31-7)32-17(2)22(29)26-13-9-14-27-23(30)19-16-24(3,4)28-25(19,5)6;/h8,11-12,15-17,28H,1,9-10,13-14H2,2-7H3,(H,26,29)(H,27,30);1H |
| InChIKey | VYKUUGWLGUNBAA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|