C23H31NO4 — CID 132658160
N-[3-(3,4-dimethoxyphenyl)propyl]-2-(2,3,5-trimethylphenoxy)propanamide (PubChem CID 132658160) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-2-(2,3,5-trimethylphenoxy)propanamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(2,3,5-trimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 132658160 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-2-(2,3,5-trimethylphenoxy)propanamide |
| SMILES | COc1ccc(CCCNC(=O)C(C)Oc2cc(C)cc(C)c2C)cc1OC |
| InChI | InChI=1S/C23H31NO4/c1-15-12-16(2)17(3)21(13-15)28-18(4)23(25)24-11-7-8-19-9-10-20(26-5)22(14-19)27-6/h9-10,12-14,18H,7-8,11H2,1-6H3,(H,24,25) |
| InChIKey | MVJZUQPUTBVUDT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|