C22H15NO3 — CID 76543899
[2-(1,3-benzoxazol-2-yl)-1-phenylethenyl] benzoate (PubChem CID 76543899) has the molecular formula C22H15NO3 and a molecular weight of 341.37 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-1-phenylethenyl] benzoate.
| Compound Name | [2-(1,3-benzoxazol-2-yl)-1-phenylethenyl] benzoate |
|---|---|
| PubChem CID | 76543899 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-1-phenylethenyl] benzoate |
| SMILES | O=C(OC(=Cc1nc2ccccc2o1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15NO3/c24-22(17-11-5-2-6-12-17)26-20(16-9-3-1-4-10-16)15-21-23-18-13-7-8-14-19(18)25-21/h1-15H |
| InChIKey | VHNUPJUVCRDHBZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|