C14H14N2O5 — CID 104964853
(2S,3R)-2-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-hydroxybutanoic acid (PubChem CID 104964853) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is (2S,3R)-2-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104964853 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2S,3R)-2-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)/C=C/c1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C14H14N2O5/c1-8(17)13(14(19)20)16-11(18)6-7-12-15-9-4-2-3-5-10(9)21-12/h2-8,13,17H,1H3,(H,16,18)(H,19,20)/b7-6+/t8-,13+/m1/s1 |
| InChIKey | BFYGCRGWMQIGRJ-WBXRYDMSSA-N |
| XLogP | 0.79 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|