C23H24N2O4 — CID 102559935
3-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-(4-tert-butylphenyl)propanoic acid (PubChem CID 102559935) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-(4-tert-butylphenyl)propanoic acid.
| Compound Name | 3-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-(4-tert-butylphenyl)propanoic acid |
|---|---|
| PubChem CID | 102559935 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-[[(E)-3-(1,3-benzoxazol-2-yl)prop-2-enoyl]amino]-3-(4-tert-butylphenyl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(C(CC(=O)O)NC(=O)/C=C/c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-23(2,3)16-10-8-15(9-11-16)18(14-22(27)28)24-20(26)12-13-21-25-17-6-4-5-7-19(17)29-21/h4-13,18H,14H2,1-3H3,(H,24,26)(H,27,28)/b13-12+ |
| InChIKey | DXGHNOXLLFWAPR-OUKQBFOZSA-N |
| XLogP | 4.47 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|