About 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride
2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride (PubChem CID 118843437) has the molecular formula C9H4ClF2NO2
and a molecular weight of 231.59 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride |
| PubChem CID | 118843437 |
| Molecular Formula | C9H4ClF2NO2 |
| Molecular Weight | 231.59 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2nc(C(F)F)oc2c1 |
| InChI | InChI=1S/C9H4ClF2NO2/c10-7(14)4-1-2-5-6(3-4)15-9(13-5)8(11)12/h1-3,8H |
| InChIKey | PHEWGTQWCRWOHY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride?
The IUPAC name of 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride (CID 118843437) is 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride.
What is the SMILES notation for 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride?
The canonical SMILES for 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride is O=C(Cl)c1ccc2nc(C(F)F)oc2c1.
What is the InChIKey of 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride?
The InChIKey is PHEWGTQWCRWOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF2NO2/c10-7(14)4-1-2-5-6(3-4)15-9(13-5)8(11)12/h1-3,8H.
What are the key properties of 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride?
2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride has a molecular weight of 231.59 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride is sourced from PubChem (CID 118843437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).