C9H4ClF2NO2 — CID 118843437
2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride (PubChem CID 118843437) has the molecular formula C9H4ClF2NO2 and a molecular weight of 231.59 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride.
| Compound Name | 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride |
|---|---|
| PubChem CID | 118843437 |
| Molecular Formula | C9H4ClF2NO2 |
| Molecular Weight | 231.59 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-(difluoromethyl)-1,3-benzoxazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2nc(C(F)F)oc2c1 |
| InChI | InChI=1S/C9H4ClF2NO2/c10-7(14)4-1-2-5-6(3-4)15-9(13-5)8(11)12/h1-3,8H |
| InChIKey | PHEWGTQWCRWOHY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|