C26H27NO4 — CID 90967137
methyl 2-[1-adamantyl(phenoxy)methyl]-1,3-benzoxazole-6-carboxylate (PubChem CID 90967137) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 2-[1-adamantyl(phenoxy)methyl]-1,3-benzoxazole-6-carboxylate.
| Compound Name | methyl 2-[1-adamantyl(phenoxy)methyl]-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 90967137 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | methyl 2-[1-adamantyl(phenoxy)methyl]-1,3-benzoxazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(C(Oc3ccccc3)C34CC5CC(CC(C5)C3)C4)oc2c1 |
| InChI | InChI=1S/C26H27NO4/c1-29-25(28)19-7-8-21-22(12-19)31-24(27-21)23(30-20-5-3-2-4-6-20)26-13-16-9-17(14-26)11-18(10-16)15-26/h2-8,12,16-18,23H,9-11,13-15H2,1H3 |
| InChIKey | GORIPQFPAOUQGE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |