C11H7Br2N3S — CID 107962399
2-(2,5-dibromothiophen-3-yl)-3H-benzimidazol-5-amine (PubChem CID 107962399) has the molecular formula C11H7Br2N3S and a molecular weight of 373.07 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 107962399 |
| Molecular Formula | C11H7Br2N3S |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 370.87 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(-c3cc(Br)sc3Br)[nH]c2c1 |
| InChI | InChI=1S/C11H7Br2N3S/c12-9-4-6(10(13)17-9)11-15-7-2-1-5(14)3-8(7)16-11/h1-4H,14H2,(H,15,16) |
| InChIKey | IJVBGPLHOKVVHD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|