C11H13N3O4S2 — CID 87674165
(2R)-2-(1,3-benzoxazol-2-ylamino)-N-methylsulfonyl-3-sulfanylpropanamide (PubChem CID 87674165) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (2R)-2-(1,3-benzoxazol-2-ylamino)-N-methylsulfonyl-3-sulfanylpropanamide.
| Compound Name | (2R)-2-(1,3-benzoxazol-2-ylamino)-N-methylsulfonyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87674165 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (2R)-2-(1,3-benzoxazol-2-ylamino)-N-methylsulfonyl-3-sulfanylpropanamide |
| SMILES | CS(=O)(=O)NC(=O)[C@H](CS)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-20(16,17)14-10(15)8(6-19)13-11-12-7-4-2-3-5-9(7)18-11/h2-5,8,19H,6H2,1H3,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | DJWJXWRBGMKQMF-QMMMGPOBSA-N |
| XLogP | 0.61 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|