About (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid
(2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid (PubChem CID 67089771) has the molecular formula C18H19N3O5S
and a molecular weight of 389.43 g/mol. Its IUPAC name is (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid.
Molecular Properties
| Compound Name | (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid |
| PubChem CID | 67089771 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid |
| SMILES | CC(c1ccc(NS(C)(=O)=O)cc1)[C@H](Nc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C18H19N3O5S/c1-11(12-7-9-13(10-8-12)21-27(2,24)25)16(17(22)23)20-18-19-14-5-3-4-6-15(14)26-18/h3-11,16,21H,1-2H3,(H,19,20)(H,22,23)/t11?,16-/m0/s1 |
| InChIKey | FZWDZTJRGDBAOK-NBFOKTCDSA-N |
| XLogP | 2.87 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid?
The IUPAC name of (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid (CID 67089771) is (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid.
What is the SMILES notation for (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid?
The canonical SMILES for (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid is CC(c1ccc(NS(C)(=O)=O)cc1)[C@H](Nc1nc2ccccc2o1)C(=O)O.
What is the InChIKey of (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid?
The InChIKey is FZWDZTJRGDBAOK-NBFOKTCDSA-N. The full InChI is InChI=1S/C18H19N3O5S/c1-11(12-7-9-13(10-8-12)21-27(2,24)25)16(17(22)23)20-18-19-14-5-3-4-6-15(14)26-18/h3-11,16,21H,1-2H3,(H,19,20)(H,22,23)/t11?,16-/m0/s1.
What are the key properties of (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid?
(2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid has a molecular weight of 389.43 g/mol, XLogP of 2.87, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,3-benzoxazol-2-ylamino)-3-[4-(methanesulfonamido)phenyl]butanoic acid is sourced from PubChem (CID 67089771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).