C13H12N2OS — CID 62842604
N-(1-thiophen-3-ylethyl)-1,3-benzoxazol-2-amine (PubChem CID 62842604) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is N-(1-thiophen-3-ylethyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(1-thiophen-3-ylethyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 62842604 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-(1-thiophen-3-ylethyl)-1,3-benzoxazol-2-amine |
| SMILES | CC(Nc1nc2ccccc2o1)c1ccsc1 |
| InChI | InChI=1S/C13H12N2OS/c1-9(10-6-7-17-8-10)14-13-15-11-4-2-3-5-12(11)16-13/h2-9H,1H3,(H,14,15) |
| InChIKey | MQLWEYAOKVCERB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |