C16H14F2N2O2 — CID 34002400
N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-1,3-benzoxazol-2-amine (PubChem CID 34002400) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 34002400 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-1,3-benzoxazol-2-amine |
| SMILES | C[C@@H](Nc1nc2ccccc2o1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H14F2N2O2/c1-10(11-6-2-4-8-13(11)21-15(17)18)19-16-20-12-7-3-5-9-14(12)22-16/h2-10,15H,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | XQEACNGSBQDTIQ-SNVBAGLBSA-N |
| XLogP | 4.60 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |