C12H13F2N3O — CID 43539990
N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1H-pyrazol-4-amine (PubChem CID 43539990) has the molecular formula C12H13F2N3O and a molecular weight of 253.25 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1H-pyrazol-4-amine.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43539990 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]ethyl]-1H-pyrazol-4-amine |
| SMILES | CC(Nc1cn[nH]c1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C12H13F2N3O/c1-8(17-9-6-15-16-7-9)10-4-2-3-5-11(10)18-12(13)14/h2-8,12,17H,1H3,(H,15,16) |
| InChIKey | NPDYORWLXYZLKY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |