C11H13N3O2 — CID 43540011
4-[1-(1H-pyrazol-4-ylamino)ethyl]benzene-1,3-diol (PubChem CID 43540011) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-[1-(1H-pyrazol-4-ylamino)ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-(1H-pyrazol-4-ylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43540011 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-[1-(1H-pyrazol-4-ylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1cn[nH]c1)c1ccc(O)cc1O |
| InChI | InChI=1S/C11H13N3O2/c1-7(14-8-5-12-13-6-8)10-3-2-9(15)4-11(10)16/h2-7,14-16H,1H3,(H,12,13) |
| InChIKey | ZKEBZPYBZBRDJT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|