C11H9F2N3O2 — CID 43429728
2-(difluoromethoxy)-N-(1H-pyrazol-4-yl)benzamide (PubChem CID 43429728) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 2-(difluoromethoxy)-N-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 43429728 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(difluoromethoxy)-N-(1H-pyrazol-4-yl)benzamide |
| SMILES | O=C(Nc1cn[nH]c1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H9F2N3O2/c12-11(13)18-9-4-2-1-3-8(9)10(17)16-7-5-14-15-6-7/h1-6,11H,(H,14,15)(H,16,17) |
| InChIKey | CGBWWYFPOSEBPR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |