C17H14F2N2O2 — CID 46481565
2-(difluoromethoxy)-N-(2-methyl-1H-indol-5-yl)benzamide (PubChem CID 46481565) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-(2-methyl-1H-indol-5-yl)benzamide.
| Compound Name | 2-(difluoromethoxy)-N-(2-methyl-1H-indol-5-yl)benzamide |
|---|---|
| PubChem CID | 46481565 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-(difluoromethoxy)-N-(2-methyl-1H-indol-5-yl)benzamide |
| SMILES | Cc1cc2cc(NC(=O)c3ccccc3OC(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C17H14F2N2O2/c1-10-8-11-9-12(6-7-14(11)20-10)21-16(22)13-4-2-3-5-15(13)23-17(18)19/h2-9,17,20H,1H3,(H,21,22) |
| InChIKey | UYYDZWMOLKJGQU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |