C15H12FN3O2 — CID 133476335
2-(1,3-benzoxazol-2-ylamino)-2-(4-fluorophenyl)acetamide (PubChem CID 133476335) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 133476335 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-2-(4-fluorophenyl)acetamide |
| SMILES | NC(=O)C(Nc1nc2ccccc2o1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FN3O2/c16-10-7-5-9(6-8-10)13(14(17)20)19-15-18-11-3-1-2-4-12(11)21-15/h1-8,13H,(H2,17,20)(H,18,19) |
| InChIKey | SUJIQNPANDHURZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |