C21H17N3O2 — CID 94546889
(2S)-2-(1,3-benzoxazol-2-ylamino)-N,2-diphenylacetamide (PubChem CID 94546889) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is (2S)-2-(1,3-benzoxazol-2-ylamino)-N,2-diphenylacetamide.
| Compound Name | (2S)-2-(1,3-benzoxazol-2-ylamino)-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 94546889 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2S)-2-(1,3-benzoxazol-2-ylamino)-N,2-diphenylacetamide |
| SMILES | O=C(Nc1ccccc1)[C@@H](Nc1nc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2/c25-20(22-16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)24-21-23-17-13-7-8-14-18(17)26-21/h1-14,19H,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | OUBSQMSEZQNEAP-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |