C12H13FN2O3 — CID 122050836
(2R)-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-3-methylbutanoic acid (PubChem CID 122050836) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is (2R)-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122050836 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2R)-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](Nc1nc2cc(F)ccc2o1)C(=O)O |
| InChI | InChI=1S/C12H13FN2O3/c1-6(2)10(11(16)17)15-12-14-8-5-7(13)3-4-9(8)18-12/h3-6,10H,1-2H3,(H,14,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | WNJXFPYDGJRLAK-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |