C11H11FN2O3 — CID 83842670
2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-2-methylpropanoic acid (PubChem CID 83842670) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83842670 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1nc2cc(F)ccc2o1)C(=O)O |
| InChI | InChI=1S/C11H11FN2O3/c1-11(2,9(15)16)14-10-13-7-5-6(12)3-4-8(7)17-10/h3-5H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | WZDLDBOVEPMLMB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |