C13H17N3O3 — CID 79892913
methyl 2-[(6-amino-1,3-benzoxazol-2-yl)amino]-3-methylbutanoate (PubChem CID 79892913) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 2-[(6-amino-1,3-benzoxazol-2-yl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(6-amino-1,3-benzoxazol-2-yl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 79892913 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 2-[(6-amino-1,3-benzoxazol-2-yl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(Nc1nc2ccc(N)cc2o1)C(C)C |
| InChI | InChI=1S/C13H17N3O3/c1-7(2)11(12(17)18-3)16-13-15-9-5-4-8(14)6-10(9)19-13/h4-7,11H,14H2,1-3H3,(H,15,16) |
| InChIKey | RBOGZXNCTHVKOK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|