C15H18N2O4 — CID 61092642
methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]-3-methylbutanoate (PubChem CID 61092642) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 61092642 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1cc2cc(N)ccc2o1)C(C)C |
| InChI | InChI=1S/C15H18N2O4/c1-8(2)13(15(19)20-3)17-14(18)12-7-9-6-10(16)4-5-11(9)21-12/h4-8,13H,16H2,1-3H3,(H,17,18) |
| InChIKey | DYWSNQGZDFHJTN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|