C13H14N2O4 — CID 61496788
methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]propanoate (PubChem CID 61496788) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 61496788 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 2-[(5-amino-1-benzofuran-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1cc2cc(N)ccc2o1 |
| InChI | InChI=1S/C13H14N2O4/c1-7(13(17)18-2)15-12(16)11-6-8-5-9(14)3-4-10(8)19-11/h3-7H,14H2,1-2H3,(H,15,16) |
| InChIKey | AUSIJGQCLQZYEU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|